What is the molecular formula of 4-Acetyl-2,3-difluorophenylboronic acid?
The molecular formula of 4-Acetyl-2,3-difluorophenylboronic acid is C8H7BF2O3.
What are some synonyms for 4-Acetyl-2,3-difluorophenylboronic acid?
Some synonyms for 4-Acetyl-2,3-difluorophenylboronic acid include 1451390-78-5, (4-Acetyl-2,3-difluorophenyl)boronic acid, SCHEMBL11303521, and MFCD13181626.
What is the molecular weight of 4-Acetyl-2,3-difluorophenylboronic acid?
The molecular weight of 4-Acetyl-2,3-difluorophenylboronic acid is 199.95 g/mol.
What is the IUPAC name of 4-Acetyl-2,3-difluorophenylboronic acid?
The IUPAC name of 4-Acetyl-2,3-difluorophenylboronic acid is (4-acetyl-2,3-difluorophenyl)boronic acid.
What is the InChI of 4-Acetyl-2,3-difluorophenylboronic acid?
The InChI of 4-Acetyl-2,3-difluorophenylboronic acid is InChI=1S/C8H7BF2O3/c1-4(12)5-2-3-6(9(13)14)8(11)7(5)10/h2-3,13-14H,1H3.
What is the InChIKey of 4-Acetyl-2,3-difluorophenylboronic acid?
The InChIKey of 4-Acetyl-2,3-difluorophenylboronic acid is HTKOABRFNDIGPM-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Acetyl-2,3-difluorophenylboronic acid?
The canonical SMILES of 4-Acetyl-2,3-difluorophenylboronic acid is B(C1=C(C(=C(C=C1)C(=O)C)F)F)(O)O.
What is the hydrogen bond donor count of 4-Acetyl-2,3-difluorophenylboronic acid?
The hydrogen bond donor count of 4-Acetyl-2,3-difluorophenylboronic acid is 2.
What is the hydrogen bond acceptor count of 4-Acetyl-2,3-difluorophenylboronic acid?
The hydrogen bond acceptor count of 4-Acetyl-2,3-difluorophenylboronic acid is 5.
What is the topological polar surface area of 4-Acetyl-2,3-difluorophenylboronic acid?
The topological polar surface area of 4-Acetyl-2,3-difluorophenylboronic acid is 57.5Ų.
※ Please kindly note that our products are for research use only.