What is the molecular formula of 4,4-Thiodibenzenethiol?
The molecular formula of 4,4-Thiodibenzenethiol is C12H10S3.
What is the molecular weight of 4,4-Thiodibenzenethiol?
The molecular weight of 4,4-Thiodibenzenethiol is 250.4 g/mol.
What is the IUPAC name of 4,4-Thiodibenzenethiol?
The IUPAC name of 4,4-Thiodibenzenethiol is 4-(4-sulfanylphenyl)sulfanylbenzenethiol.
What is the InChI of 4,4-Thiodibenzenethiol?
The InChI of 4,4-Thiodibenzenethiol is InChI=1S/C12H10S3/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,13-14H.
What is the InChIKey of 4,4-Thiodibenzenethiol?
The InChIKey of 4,4-Thiodibenzenethiol is JLLMOYPIVVKFHY-UHFFFAOYSA-N.
What is the canonical SMILES of 4,4-Thiodibenzenethiol?
The canonical SMILES of 4,4-Thiodibenzenethiol is C1=CC(=CC=C1S)SC2=CC=C(C=C2)S.
What is the CAS number of 4,4-Thiodibenzenethiol?
The CAS number of 4,4-Thiodibenzenethiol is 19362-77-7.
What is the XLogP3 of 4,4-Thiodibenzenethiol?
The XLogP3 of 4,4-Thiodibenzenethiol is 4.4.
What is the hydrogen bond donor count of 4,4-Thiodibenzenethiol?
The hydrogen bond donor count of 4,4-Thiodibenzenethiol is 2.
What is the hydrogen bond acceptor count of 4,4-Thiodibenzenethiol?
The hydrogen bond acceptor count of 4,4-Thiodibenzenethiol is 3.