What is the molecular formula of 4,4-Oxybisbenzoic acid?
The molecular formula of 4,4-Oxybisbenzoic acid is C14H10O5.
What is the molecular weight of 4,4-Oxybisbenzoic acid?
The molecular weight of 4,4-Oxybisbenzoic acid is 258.23 g/mol.
What is the IUPAC name of 4,4-Oxybisbenzoic acid?
The IUPAC name of 4,4-Oxybisbenzoic acid is 4-(4-carboxyphenoxy)benzoic acid.
What is the InChI of 4,4-Oxybisbenzoic acid?
The InChI of 4,4-Oxybisbenzoic acid is InChI=1S/C14H10O5/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H,(H,15,16)(H,17,18).
What is the InChIKey of 4,4-Oxybisbenzoic acid?
The InChIKey of 4,4-Oxybisbenzoic acid is WVDRSXGPQWNUBN-UHFFFAOYSA-N.
What is the canonical SMILES of 4,4-Oxybisbenzoic acid?
The canonical SMILES of 4,4-Oxybisbenzoic acid is C1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)C(=O)O.
What is the CAS number of 4,4-Oxybisbenzoic acid?
The CAS number of 4,4-Oxybisbenzoic acid is 2215-89-6.
How many hydrogen bond donor counts does 4,4-Oxybisbenzoic acid have?
4,4-Oxybisbenzoic acid has 2 hydrogen bond donor counts.
How many rotatable bond counts does 4,4-Oxybisbenzoic acid have?
4,4-Oxybisbenzoic acid has 4 rotatable bond counts.