The molecular formula of the compound is C14H10O6.
What are the synonyms for the compound?
The synonyms for the compound are 13987-45-6, 5-(3-Carboxy-4-hydroxyphenyl)-2-hydroxybenzoic acid, 4,4'-Dihydroxybiphenyl-3,3'-dicarboxylic acid, 4,4'-Dihydroxy-[1,1'-biphenyl]-3,3'-dicarboxylic acid, and 4,4'-dihydroxy-(1,1'-biphenyl)-3,3'-dicarboxylic acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 274.22 g/mol.
When was the compound created?
The compound was created on October 26, 2006.
When was the compound last modified?
The compound was last modified on October 21, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-(3-carboxy-4-hydroxyphenyl)-2-hydroxybenzoic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C14H10O6/c15-11-3-1-7(5-9(11)13(17)18)8-2-4-12(16)10(6-8)14(19)20/h1-6,15-16H,(H,17,18)(H,19,20).
What is the InChIKey of the compound?
The InChIKey of the compound is UISWLBIMLGAHMF-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=C(C=C1C2=CC(=C(C=C2)O)C(=O)O)C(=O)O).
What is the CAS number of the compound?
The CAS number of the compound is 13987-45-6.
※ Please kindly note that our products are for research use only.