What is the PubChem CID for 4,4-Biphenol?
The PubChem CID for 4,4-Biphenol is 7112.
What is the molecular formula of 4,4-Biphenol?
The molecular formula of 4,4-Biphenol is C12H10O2.
What is the molecular weight of 4,4-Biphenol?
The molecular weight of 4,4-Biphenol is 186.21 g/mol.
What are the synonyms for 4,4-Biphenol?
The synonyms for 4,4-Biphenol are 4,4'-Dihydroxybiphenyl, 4,4'-BIPHENOL, and Biphenyl-4,4'-diol.
What is the IUPAC name of 4,4-Biphenol?
The IUPAC name of 4,4-Biphenol is 4-(4-hydroxyphenyl)phenol.
What is the InChI of 4,4-Biphenol?
The InChI of 4,4-Biphenol is InChI=1S/C12H10O2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8,13-14H.
What is the InChIKey of 4,4-Biphenol?
The InChIKey of 4,4-Biphenol is VCCBEIPGXKNHFW-UHFFFAOYSA-N.
What is the canonical SMILES of 4,4-Biphenol?
The canonical SMILES of 4,4-Biphenol is C1=CC(=CC=C1C2=CC=C(C=C2)O)O.
What is the CAS number of 4,4-Biphenol?
The CAS number of 4,4-Biphenol is 92-88-6.
What is the hydrogen bond donor count of 4,4-Biphenol?
The hydrogen bond donor count of 4,4-Biphenol is 2.