The IUPAC name is 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C22H24O2/c23-19-5-1-17(2-6-19)21-10-15-9-16(11-21)13-22(12-15,14-21)18-3-7-20(24)8-4-18/h1-8,15-16,23-24H,9-14H2.
What is the InChIKey of the compound?
The InChIKey is DNLWYVQYADCTEU-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is C1C2CC3(CC1CC(C2)(C3)C4=CC=C(C=C4)O).
What is the CAS number of the compound?
The CAS number is 37677-93-3.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID is DTXSID40403455.
What is the Nikkaji Number of the compound?
The Nikkaji Number is J667.374K.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.