In the preparation of coatings, (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate is used as an auxiliary agent to obtain good paint film performance.
What is the molecular formula of (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate?
The molecular formula is C15H22O2Si.
What is the molecular weight of (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate?
The molecular weight is 262.42 g/mol.
What is the IUPAC name of (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate?
The IUPAC name is methyl (E,3R)-3-[dimethyl(phenyl)silyl]hex-4-enoate.
What is the InChI of (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate?
The InChI is InChI=1S/C15H22O2Si/c1-5-9-14(12-15(16)17-2)18(3,4)13-10-7-6-8-11-13/h5-11,14H,12H2,1-4H3/b9-5+/t14-/m0/s1.
What is the Canonical SMILES of (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate?
The Canonical SMILES is CC=CC(CC(=O)OC)[Si](C)(C)C1=CC=CC=C1.
What is the CAS number of (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate?
The CAS number is 136174-52-2.
What is the EC Number of (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate?
The EC Number is 663-673-5.
What is the hydrogen bond donor count of (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate?
The hydrogen bond donor count is 0.
What is the rotatable bond count of (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate?
The rotatable bond count is 6.
Is (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate a canonicalized compound?
Yes, (3R,4E)-Methyl 3-(dimethylphenylsilyl)-4-hexenoate is canonicalized.
※ Please kindly note that our products are for research use only.