What is the molecular formula of (+)-cucurbic acid?
The molecular formula of (+)-cucurbic acid is C12H20O3.
What is the molecular weight of (+)-cucurbic acid?
The molecular weight of (+)-cucurbic acid is 212.28 g/mol.
What is the IUPAC name of (+)-cucurbic acid?
The IUPAC name of (+)-cucurbic acid is 2-[(1R,2S,3S)-3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid.
What is the InChI of (+)-cucurbic acid?
The InChI of (+)-cucurbic acid is InChI=1S/C12H20O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-11,13H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10+,11+/m1/s1.
What is the InChIKey of (+)-cucurbic acid?
The InChIKey of (+)-cucurbic acid is LYSGIJUGUGJIPS-UOMVISFLSA-N.
What is the canonical SMILES of (+)-cucurbic acid?
The canonical SMILES of (+)-cucurbic acid is CCC=CCC1C(CCC1O)CC(=O)O.
What is the CAS number of (+)-cucurbic acid?
The CAS number of (+)-cucurbic acid is 58240-50-9.
What is the ChEMBL ID of (+)-cucurbic acid?
The ChEMBL ID of (+)-cucurbic acid is CHEMBL2272539.
How many hydrogen bond donor counts does (+)-cucurbic acid have?
(+)-cucurbic acid has 2 hydrogen bond donor counts.
How many rotatable bond counts does (+)-cucurbic acid have?
(+)-cucurbic acid has 5 rotatable bond counts.
※ Please kindly note that our products are for research use only.