What is the PubChem CID for 3-(Trifluoromethoxy)benzeneboronic acid, pinacol ester?
PubChem CID 2760602.
What is the molecular formula of 3-(Trifluoromethoxy)benzeneboronic acid, pinacol ester?
The molecular formula is C13H16BF3O3.
What are some synonyms for 3-(Trifluoromethoxy)benzeneboronic acid, pinacol ester?
Some synonyms include 262376-31-8, 4,4,5,5-Tetramethyl-2-(3-(trifluoromethoxy)phenyl)-1,3,2-dioxaborolane, and 4,4,5,5-tetramethyl-2-[3-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane.
What is the molecular weight of 3-(Trifluoromethoxy)benzeneboronic acid, pinacol ester?
The molecular weight is 288.07 g/mol.
When was it created and modified?
It was created on July 19, 2005, and last modified on December 2, 2023.
What is the IUPAC name of 3-(Trifluoromethoxy)benzeneboronic acid, pinacol ester?
The IUPAC name is 4,4,5,5-tetramethyl-2-[3-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane.
What is the InChI of 3-(Trifluoromethoxy)benzeneboronic acid, pinacol ester?
The InChI is InChI=1S/C13H16BF3O3/c1-11(2)12(3,4)20-14(19-11)9-6-5-7-10(8-9)18-13(15,16)17/h5-8H,1-4H3.
What is the InChIKey of 3-(Trifluoromethoxy)benzeneboronic acid, pinacol ester?
The InChIKey is BUSBFOTXIPZTDH-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-(Trifluoromethoxy)benzeneboronic acid, pinacol ester?
The Canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OC(F)(F)F.
What is the CAS number of 3-(Trifluoromethoxy)benzeneboronic acid, pinacol ester?
The CAS number is 262376-31-8.
※ Please kindly note that our products are for research use only.