What is the molecular formula of Pyridine-3-boronic acid?
The molecular formula of Pyridine-3-boronic acid is C5H6BNO2.
What is the molecular weight of Pyridine-3-boronic acid?
The molecular weight of Pyridine-3-boronic acid is 122.92 g/mol.
What is the IUPAC name of Pyridine-3-boronic acid?
The IUPAC name of Pyridine-3-boronic acid is pyridin-3-ylboronic acid.
What is the InChI of Pyridine-3-boronic acid?
The InChI of Pyridine-3-boronic acid is InChI=1S/C5H6BNO2/c8-6(9)5-2-1-3-7-4-5/h1-4,8-9H.
What is the InChIKey of Pyridine-3-boronic acid?
The InChIKey of Pyridine-3-boronic acid is ABMYEXAYWZJVOV-UHFFFAOYSA-N.
What is the canonical SMILES of Pyridine-3-boronic acid?
The canonical SMILES of Pyridine-3-boronic acid is B(C1=CN=CC=C1)(O)O.
What is the CAS number of Pyridine-3-boronic acid?
The CAS number of Pyridine-3-boronic acid is 1692-25-7.
What is the ChEMBL ID of Pyridine-3-boronic acid?
The ChEMBL ID of Pyridine-3-boronic acid is CHEMBL3236605.
What is the DSSTox Substance ID of Pyridine-3-boronic acid?
The DSSTox Substance ID of Pyridine-3-boronic acid is DTXSID30370268.
Is Pyridine-3-boronic acid a canonicalized compound?
Yes, Pyridine-3-boronic acid is a canonicalized compound according to PubChem.