What is the PubChem CID for 3-Propylphenol?
The PubChem CID for 3-Propylphenol is 69302.
What is the molecular formula of 3-Propylphenol?
The molecular formula of 3-Propylphenol is C9H12O.
What are the synonyms for 3-Propylphenol?
The synonyms for 3-Propylphenol are 3-n-Propylphenol, 621-27-2, m-Propylphenol, and Phenol, 3-propyl-.
What is the molecular weight of 3-Propylphenol?
The molecular weight of 3-Propylphenol is 136.19 g/mol.
What is the IUPAC name of 3-Propylphenol?
The IUPAC name of 3-Propylphenol is 3-propylphenol.
What is the InChI of 3-Propylphenol?
The InChI of 3-Propylphenol is InChI=1S/C9H12O/c1-2-4-8-5-3-6-9(10)7-8/h3,5-7,10H,2,4H2,1H3.
What is the InChIKey of 3-Propylphenol?
The InChIKey of 3-Propylphenol is MPWGZBWDLMDIHO-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Propylphenol?
The canonical SMILES of 3-Propylphenol is CCCC1=CC(=CC=C1)O.
What is the CAS number of 3-Propylphenol?
The CAS number of 3-Propylphenol is 621-27-2.
What is the XLogP3 value of 3-Propylphenol?
The XLogP3 value of 3-Propylphenol is 2.9.