What is the molecular formula of 3-Phenylthiophene?
The molecular formula of 3-Phenylthiophene is C10H8S.
What is the molecular weight of 3-Phenylthiophene?
The molecular weight of 3-Phenylthiophene is 160.24 g/mol.
What is the IUPAC name of 3-Phenylthiophene?
The IUPAC name of 3-Phenylthiophene is 3-phenylthiophene.
What is the InChI of 3-Phenylthiophene?
The InChI of 3-Phenylthiophene is InChI=1S/C10H8S/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-8H.
What is the InChIKey of 3-Phenylthiophene?
The InChIKey of 3-Phenylthiophene is ZDQZVKVIYAPRON-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Phenylthiophene?
The canonical SMILES of 3-Phenylthiophene is C1=CC=C(C=C1)C2=CSC=C2.
What is the CAS number of 3-Phenylthiophene?
The CAS number of 3-Phenylthiophene is 2404-87-7.
What is the XLogP3-AA value of 3-Phenylthiophene?
The XLogP3-AA value of 3-Phenylthiophene is 3.2.
How many hydrogen bond donor count does 3-Phenylthiophene have?
3-Phenylthiophene has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does 3-Phenylthiophene have?
3-Phenylthiophene has 1 hydrogen bond acceptor count.