What is the molecular formula of 3-Phenoxybenzyl chloride?
The molecular formula of 3-Phenoxybenzyl chloride is C13H11ClO.
What is the molecular weight of 3-Phenoxybenzyl chloride?
The molecular weight of 3-Phenoxybenzyl chloride is 218.68 g/mol.
What is the IUPAC name of 3-Phenoxybenzyl chloride?
The IUPAC name of 3-Phenoxybenzyl chloride is 1-(chloromethyl)-3-phenoxybenzene.
What is the InChI of 3-Phenoxybenzyl chloride?
The InChI of 3-Phenoxybenzyl chloride is InChI=1S/C13H11ClO/c14-10-11-5-4-8-13(9-11)15-12-6-2-1-3-7-12/h1-9H,10H2.
What is the InChIKey of 3-Phenoxybenzyl chloride?
The InChIKey of 3-Phenoxybenzyl chloride is QUYVTGFWFHQVRO-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Phenoxybenzyl chloride?
The Canonical SMILES of 3-Phenoxybenzyl chloride is C1=CC=C(C=C1)OC2=CC=CC(=C2)CCl.
What is the CAS number of 3-Phenoxybenzyl chloride?
The CAS number of 3-Phenoxybenzyl chloride is 53874-66-1.
What is the EC number of 3-Phenoxybenzyl chloride?
The EC number of 3-Phenoxybenzyl chloride is 258-831-1.
What is the UNII of 3-Phenoxybenzyl chloride?
The UNII of 3-Phenoxybenzyl chloride is Q8R767G4B4.
Is 3-Phenoxybenzyl chloride a canonicalized compound?
Yes, 3-Phenoxybenzyl chloride is a canonicalized compound.