What is the molecular formula of 3-Phenoxyaniline?
The molecular formula of 3-Phenoxyaniline is C12H11NO.
What is the molecular weight of 3-Phenoxyaniline?
The molecular weight of 3-Phenoxyaniline is 185.22 g/mol.
What is the IUPAC name of 3-Phenoxyaniline?
The IUPAC name of 3-Phenoxyaniline is 3-phenoxyaniline.
What is the InChI of 3-Phenoxyaniline?
The InChI of 3-Phenoxyaniline is InChI=1S/C12H11NO/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9H,13H2.
What is the InChIKey of 3-Phenoxyaniline?
The InChIKey of 3-Phenoxyaniline is UCSYVYFGMFODMY-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Phenoxyaniline?
The canonical SMILES of 3-Phenoxyaniline is C1=CC=C(C=C1)OC2=CC=CC(=C2)N.
What is the CAS number of 3-Phenoxyaniline?
The CAS number of 3-Phenoxyaniline is 3586-12-7.
What is the EC number of 3-Phenoxyaniline?
The EC number of 3-Phenoxyaniline is 222-715-9.
What is the ChEMBL ID of 3-Phenoxyaniline?
The ChEMBL ID of 3-Phenoxyaniline is CHEMBL1642683.
What is the topological polar surface area of 3-Phenoxyaniline?
The topological polar surface area of 3-Phenoxyaniline is 35.2Ų.