What is the molecular formula of the compound?
The molecular formula of the compound is C18H28BNO4.
What are the synonyms for the compound?
The synonyms for the compound are 832114-05-3, tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzylcarbamate, 3-(n-boc-aminomethyl)phenylboronic acid pinacol ester, and Tert-butyl N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate.
What is the molecular weight of the compound?
The molecular weight of the compound is 333.2 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is tert-butyl N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate.
What is the InChI (International Chemical Identifier) of the compound?
The InChI of the compound is InChI=1S/C18H28BNO4/c1-16(2,3)22-15(21)20-12-13-9-8-10-14(11-13)19-23-17(4,5)18(6,7)24-19/h8-11H,12H2,1-7H3,(H,20,21).
What is the InChIKey of the compound?
The InChIKey of the compound is ANBFXKONRFZJAO-UHFFFAOYSA-N.
What is the canonical SMILES (Simplified Molecular Input Line Entry System) of the compound?
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CNC(=O)OC(C)(C)C.
What is the CAS (Chemical Abstracts Service) number of the compound?
The CAS number of the compound is 832114-05-3.
How many hydrogen bond donor and acceptor counts are there in the compound?
The compound has 1 hydrogen bond donor count and 4 hydrogen bond acceptor counts.
How many rotatable bonds are there in the compound?
The compound has 5 rotatable bonds.