What is the molecular formula of 3-Methylheptadecane?
The molecular formula of 3-Methylheptadecane is C18H38.
What is the molecular weight of 3-Methylheptadecane?
The molecular weight of 3-Methylheptadecane is 254.5 g/mol.
What is the IUPAC name of 3-Methylheptadecane?
The IUPAC name of 3-Methylheptadecane is 3-methylheptadecane.
What is the InChI of 3-Methylheptadecane?
The InChI of 3-Methylheptadecane is InChI=1S/C18H38/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18(3)5-2/h18H,4-17H2,1-3H3.
What is the InChIKey of 3-Methylheptadecane?
The InChIKey of 3-Methylheptadecane is HPDKJRSKBCPMIY-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methylheptadecane?
The canonical SMILES of 3-Methylheptadecane is CCCCCCCCCCCCCCC(C)CC.
What is the CAS number of 3-Methylheptadecane?
The CAS number of 3-Methylheptadecane is 6418-44-6.
What is the European Community (EC) number of 3-Methylheptadecane?
The European Community (EC) number of 3-Methylheptadecane is 680-585-2.
What is the Lipid Maps ID (LM_ID) of 3-Methylheptadecane?
The Lipid Maps ID (LM_ID) of 3-Methylheptadecane is LMFA11000397.
What is the hydrogen bond donor count of 3-Methylheptadecane?
The hydrogen bond donor count of 3-Methylheptadecane is 0.