What is the molecular formula of 3-Methylbutanohydrazide?
The molecular formula of 3-Methylbutanohydrazide is C5H12N2O.
What is the molecular weight of 3-Methylbutanohydrazide?
The molecular weight of 3-Methylbutanohydrazide is 116.16 g/mol.
What is the IUPAC name of 3-Methylbutanohydrazide?
The IUPAC name of 3-Methylbutanohydrazide is 3-methylbutanehydrazide.
What is the InChI of 3-Methylbutanohydrazide?
The InChI of 3-Methylbutanohydrazide is InChI=1S/C5H12N2O/c1-4(2)3-5(8)7-6/h4H,3,6H2,1-2H3,(H,7,8).
What is the InChIKey of 3-Methylbutanohydrazide?
The InChIKey of 3-Methylbutanohydrazide is OQNKZWDYYSHLPO-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Methylbutanohydrazide?
The Canonical SMILES of 3-Methylbutanohydrazide is CC(C)CC(=O)NN.
What is the CAS number of 3-Methylbutanohydrazide?
The CAS number of 3-Methylbutanohydrazide is 24310-18-7.
What is the UNII of 3-Methylbutanohydrazide?
The UNII of 3-Methylbutanohydrazide is 9KR4OE07SP.
What is the Nikkaji Number of 3-Methylbutanohydrazide?
The Nikkaji Number of 3-Methylbutanohydrazide is J1.607.320B.
Is 3-Methylbutanohydrazide a Canonicalized compound?
Yes, 3-Methylbutanohydrazide is a Canonicalized compound.