What is the molecular formula of 3-Methyl-1,2-butadiene?
The molecular formula of 3-Methyl-1,2-butadiene is C5H8.
What is the molecular weight of 3-Methyl-1,2-butadiene?
The molecular weight of 3-Methyl-1,2-butadiene is 68.12 g/mol.
What is the InChI of 3-Methyl-1,2-butadiene?
The InChI of 3-Methyl-1,2-butadiene is InChI=1S/C5H8/c1-4-5(2)3/h1H2,2-3H3.
What is the InChIKey of 3-Methyl-1,2-butadiene?
The InChIKey of 3-Methyl-1,2-butadiene is PAKGDPSCXSUALC-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methyl-1,2-butadiene?
The canonical SMILES of 3-Methyl-1,2-butadiene is CC(=C=C)C.
What is the CAS number of 3-Methyl-1,2-butadiene?
The CAS number of 3-Methyl-1,2-butadiene is 598-25-4.
What is the European Community (EC) number of 3-Methyl-1,2-butadiene?
The European Community (EC) number of 3-Methyl-1,2-butadiene is 209-926-1.
What is the UNII of 3-Methyl-1,2-butadiene?
The UNII of 3-Methyl-1,2-butadiene is NQO612O389.
What is the DSSTox Substance ID of 3-Methyl-1,2-butadiene?
The DSSTox Substance ID of 3-Methyl-1,2-butadiene is DTXSID00208529.
Is 3-Methyl-1,2-butadiene a canonicalized compound?
No, 3-Methyl-1,2-butadiene is not a canonicalized compound.