What is the PubChem CID of 3-Methoxytriphenylamine?
The PubChem CID of 3-Methoxytriphenylamine is 14746719.
What is the molecular formula of 3-Methoxytriphenylamine?
The molecular formula of 3-Methoxytriphenylamine is C19H17NO.
What is the molecular weight of 3-Methoxytriphenylamine?
The molecular weight of 3-Methoxytriphenylamine is 275.3 g/mol.
What is the IUPAC name of 3-Methoxytriphenylamine?
The IUPAC name of 3-Methoxytriphenylamine is 3-methoxy-N,N-diphenylaniline.
What is the InChI of 3-Methoxytriphenylamine?
The InChI of 3-Methoxytriphenylamine is InChI=1S/C19H17NO/c1-21-19-14-8-13-18(15-19)20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-15H,1H3.
What is the InChIKey of 3-Methoxytriphenylamine?
The InChIKey of 3-Methoxytriphenylamine is MVIPGWFTBPVNBJ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methoxytriphenylamine?
The canonical SMILES of 3-Methoxytriphenylamine is COC1=CC=CC(=C1)N(C2=CC=CC=C2)C3=CC=CC=C3.
What is the CAS number of 3-Methoxytriphenylamine?
The CAS number of 3-Methoxytriphenylamine is 20588-62-9.
What is the XLogP3-AA value of 3-Methoxytriphenylamine?
The XLogP3-AA value of 3-Methoxytriphenylamine is 5.1.
Is 3-Methoxytriphenylamine a canonicalized compound?
Yes, 3-Methoxytriphenylamine is a canonicalized compound according to PubChem.