What is the PubChem CID of 3-Methoxybenzyl bromide?
PubChem CID 4067207
What is the molecular formula of 3-Methoxybenzyl bromide?
The molecular formula is C8H9BrO.
What is the molecular weight of 3-Methoxybenzyl bromide?
The molecular weight is 201.06 g/mol.
What is the IUPAC name of 3-Methoxybenzyl bromide?
The IUPAC name is 1-(bromomethyl)-3-methoxybenzene.
What is the InChI of 3-Methoxybenzyl bromide?
The InChI is InChI=1S/C8H9BrO/c1-10-8-4-2-3-7(5-8)6-9/h2-5H,6H2,1H3.
What is the InChIKey of 3-Methoxybenzyl bromide?
The InChIKey is ZKSOJQDNSNJIQW-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methoxybenzyl bromide?
The canonical SMILES is COC1=CC=CC(=C1)CBr.
What is the CAS number of 3-Methoxybenzyl bromide?
The CAS number is 874-98-6.
What is the XLogP3 value of 3-Methoxybenzyl bromide?
The XLogP3 value is 2.6.
Is 3-Methoxybenzyl bromide a canonicalized compound?
Yes, it is canonicalized according to PubChem.