What is the molecular formula of 3-Iodophenylboronic acid?
The molecular formula of 3-Iodophenylboronic acid is C6H6BIO2.
What is the molecular weight of 3-Iodophenylboronic acid?
The molecular weight of 3-Iodophenylboronic acid is 247.83 g/mol.
What is the IUPAC name of 3-Iodophenylboronic acid?
The IUPAC name of 3-Iodophenylboronic acid is (3-iodophenyl)boronic acid.
What is the InChI of 3-Iodophenylboronic acid?
The InChI of 3-Iodophenylboronic acid is InChI=1S/C6H6BIO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H.
What is the InChIKey of 3-Iodophenylboronic acid?
The InChIKey of 3-Iodophenylboronic acid is REEUXWXIMNEIIN-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Iodophenylboronic acid?
The canonical SMILES of 3-Iodophenylboronic acid is B(C1=CC(=CC=C1)I)(O)O.
What is the CAS number of 3-Iodophenylboronic acid?
The CAS number of 3-Iodophenylboronic acid is 221037-98-5.
What is the European Community (EC) number of 3-Iodophenylboronic acid?
The European Community (EC) number of 3-Iodophenylboronic acid is 627-272-9.
What is the Nikkaji number of 3-Iodophenylboronic acid?
The Nikkaji number of 3-Iodophenylboronic acid is J1.568.477A.
Is 3-Iodophenylboronic acid a canonicalized compound?
Yes, 3-Iodophenylboronic acid is a canonicalized compound.