What is the PubChem CID of 3-Iodoanisole?
The PubChem CID of 3-Iodoanisole is 69839.
What is the molecular formula of 3-Iodoanisole?
The molecular formula of 3-Iodoanisole is C7H7IO.
What are the synonyms of 3-Iodoanisole?
The synonyms of 3-Iodoanisole include 1-Iodo-3-methoxybenzene, m-Iodoanisole, and Benzene, 1-iodo-3-methoxy-, among others.
What is the molecular weight of 3-Iodoanisole?
The molecular weight of 3-Iodoanisole is 234.03 g/mol.
What is the IUPAC name of 3-Iodoanisole?
The IUPAC name of 3-Iodoanisole is 1-iodo-3-methoxybenzene.
What is the InChI of 3-Iodoanisole?
The InChI of 3-Iodoanisole is InChI=1S/C7H7IO/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3.
What is the InChIKey of 3-Iodoanisole?
The InChIKey of 3-Iodoanisole is RSHBAGGASAJQCH-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Iodoanisole?
The canonical SMILES of 3-Iodoanisole is COC1=CC(=CC=C1)I.
What is the CAS number of 3-Iodoanisole?
The CAS number of 3-Iodoanisole is 766-85-8.
Is 3-Iodoanisole a canonicalized compound?
Yes, 3-Iodoanisole is a canonicalized compound.