What is the molecular formula of 3-Hydroxy pravastatin?
The molecular formula of 3-Hydroxy pravastatin is C23H36O8.
What is the molecular weight of 3-Hydroxy pravastatin?
The molecular weight of 3-Hydroxy pravastatin is 440.5 g/mol.
What is the IUPAC name of 3-Hydroxy pravastatin?
The IUPAC name of 3-Hydroxy pravastatin is (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-8-[(2S,3R)-3-hydroxy-2-methylbutanoyl]oxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid.
What is the InChI of 3-Hydroxy pravastatin?
The InChI of 3-Hydroxy pravastatin is InChI=1S/C23H36O8/c1-12-4-5-15-8-17(26)10-20(31-23(30)13(2)14(3)24)22(15)19(12)7-6-16(25)9-18(27)11-21(28)29/h4-5,8,12-14,16-20,22,24-27H,6-7,9-11H2,1-3H3,(H,28,29)/t12-,13-,14+,16+,17+,18+,19-,20-,22-/m0/s1.
What is the InChIKey of 3-Hydroxy pravastatin?
The InChIKey of 3-Hydroxy pravastatin is ASZMMNUWSMFMJO-HMCXMWFFSA-N.
What is the canonical SMILES of 3-Hydroxy pravastatin?
The canonical SMILES of 3-Hydroxy pravastatin is CC1C=CC2=CC(CC(C2C1CCC(CC(CC(=O)O)O)O)OC(=O)C(C)C(C)O)O.
What is the CAS number of 3-Hydroxy pravastatin?
The CAS number of 3-Hydroxy pravastatin is 773073-26-0.
How many hydrogen bond donor counts are there in 3-Hydroxy pravastatin?
There are 5 hydrogen bond donor counts in 3-Hydroxy pravastatin.
How many hydrogen bond acceptor counts are there in 3-Hydroxy pravastatin?
There are 8 hydrogen bond acceptor counts in 3-Hydroxy pravastatin.