What is the molecular formula of 3-Hydroxy-N-2-naphthyl-2-naphthamide?
The molecular formula of 3-Hydroxy-N-2-naphthyl-2-naphthamide is C21H15NO2.
What is the molecular weight of 3-Hydroxy-N-2-naphthyl-2-naphthamide?
The molecular weight of 3-Hydroxy-N-2-naphthyl-2-naphthamide is 313.3 g/mol.
What is the IUPAC Name of 3-Hydroxy-N-2-naphthyl-2-naphthamide?
The IUPAC Name of 3-Hydroxy-N-2-naphthyl-2-naphthamide is 3-hydroxy-N-naphthalen-2-ylnaphthalene-2-carboxamide.
What is the InChI of 3-Hydroxy-N-2-naphthyl-2-naphthamide?
The InChI of 3-Hydroxy-N-2-naphthyl-2-naphthamide is InChI=1S/C21H15NO2/c23-20-13-17-8-4-3-7-16(17)12-19(20)21(24)22-18-10-9-14-5-1-2-6-15(14)11-18/h1-13,23H,(H,22,24).
What is the InChIKey of 3-Hydroxy-N-2-naphthyl-2-naphthamide?
The InChIKey of 3-Hydroxy-N-2-naphthyl-2-naphthamide is PMYDPQQPEAYXKD-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Hydroxy-N-2-naphthyl-2-naphthamide?
The canonical SMILES of 3-Hydroxy-N-2-naphthyl-2-naphthamide is C1=CC=C2C=C(C=CC2=C1)NC(=O)C3=CC4=CC=CC=C4C=C3O.
What is the CAS number of 3-Hydroxy-N-2-naphthyl-2-naphthamide?
The CAS number of 3-Hydroxy-N-2-naphthyl-2-naphthamide is 135-64-8.
What is the molecular weight of 3-Hydroxy-N-2-naphthyl-2-naphthamide according to PubChem?
The molecular weight of 3-Hydroxy-N-2-naphthyl-2-naphthamide is 313.3 g/mol according to PubChem.
What is the XLogP3-AA value of 3-Hydroxy-N-2-naphthyl-2-naphthamide?
The XLogP3-AA value of 3-Hydroxy-N-2-naphthyl-2-naphthamide is 5.5.
How many hydrogen bond donor counts does 3-Hydroxy-N-2-naphthyl-2-naphthamide have?
3-Hydroxy-N-2-naphthyl-2-naphthamide has 2 hydrogen bond donor counts.
How many hydrogen bond donor counts are there in 3-Hydroxy-N-2-naphthyl-2-naphthamide?
There are 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 3-Hydroxy-N-2-naphthyl-2-naphthamide?
There are 2 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.
Download
