What is the molecular formula of 3-Fluorothiophenol?
The molecular formula of 3-Fluorothiophenol is C6H5FS.
What is the molecular weight of 3-Fluorothiophenol?
The molecular weight of 3-Fluorothiophenol is 128.17 g/mol.
What is the IUPAC name of 3-Fluorothiophenol?
The IUPAC name of 3-Fluorothiophenol is 3-fluorobenzenethiol.
What is the InChI of 3-Fluorothiophenol?
The InChI of 3-Fluorothiophenol is InChI=1S/C6H5FS/c7-5-2-1-3-6(8)4-5/h1-4,8H.
What is the InChIKey of 3-Fluorothiophenol?
The InChIKey of 3-Fluorothiophenol is ZDEUGINAVLMAET-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluorothiophenol?
The canonical SMILES of 3-Fluorothiophenol is C1=CC(=CC(=C1)S)F.
What is the CAS number of 3-Fluorothiophenol?
The CAS number of 3-Fluorothiophenol is 2557-77-9.
What is the European Community (EC) number of 3-Fluorothiophenol?
The European Community (EC) number of 3-Fluorothiophenol is 219-876-2.
What is the DSSTox Substance ID of 3-Fluorothiophenol?
The DSSTox Substance ID of 3-Fluorothiophenol is DTXSID10180261.
Is 3-Fluorothiophenol a canonicalized compound?
Yes, 3-Fluorothiophenol is a canonicalized compound according to PubChem.