What is the molecular formula of 3-Fluorobenzylamine?
The molecular formula of 3-Fluorobenzylamine is C7H8FN.
What is the molecular weight of 3-Fluorobenzylamine?
The molecular weight of 3-Fluorobenzylamine is 125.14 g/mol.
What is the IUPAC name of 3-Fluorobenzylamine?
The IUPAC name of 3-Fluorobenzylamine is (3-fluorophenyl)methanamine.
What is the InChI code of 3-Fluorobenzylamine?
The InChI code of 3-Fluorobenzylamine is InChI=1S/C7H8FN/c8-7-3-1-2-6(4-7)5-9/h1-4H,5,9H2.
What is the InChIKey of 3-Fluorobenzylamine?
The InChIKey of 3-Fluorobenzylamine is QVSVMNXRLWSNGS-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluorobenzylamine?
The canonical SMILES of 3-Fluorobenzylamine is C1=CC(=CC(=C1)F)CN.
What is the CAS number of 3-Fluorobenzylamine?
The CAS number of 3-Fluorobenzylamine is 100-82-3.
What is the ChEMBL ID of 3-Fluorobenzylamine?
The ChEMBL ID of 3-Fluorobenzylamine is CHEMBL12722.
What is the XLogP3 value of 3-Fluorobenzylamine?
The XLogP3 value of 3-Fluorobenzylamine is 1.2.
Is 3-Fluorobenzylamine a canonicalized compound?
Yes, 3-Fluorobenzylamine is a canonicalized compound.