What is the molecular formula of 3-Fluorobenzaldehyde?
The molecular formula of 3-Fluorobenzaldehyde is C7H5FO.
What is the molecular weight of 3-Fluorobenzaldehyde?
The molecular weight of 3-Fluorobenzaldehyde is 124.11 g/mol.
What is the IUPAC name of 3-Fluorobenzaldehyde?
The IUPAC name of 3-Fluorobenzaldehyde is "3-fluorobenzaldehyde."
What is the InChI of 3-Fluorobenzaldehyde?
The InChI of 3-Fluorobenzaldehyde is "InChI=1S/C7H5FO/c8-7-3-1-2-6(4-7)5-9/h1-5H."
What is the InChIKey of 3-Fluorobenzaldehyde?
The InChIKey of 3-Fluorobenzaldehyde is "PIKNVEVCWAAOMJ-UHFFFAOYSA-N."
What is the canonical SMILES of 3-Fluorobenzaldehyde?
The canonical SMILES of 3-Fluorobenzaldehyde is "C1=CC(=CC(=C1)F)C=O."
What is the CAS number of 3-Fluorobenzaldehyde?
The CAS number of 3-Fluorobenzaldehyde is 456-48-4.
What is the European Community (EC) number of 3-Fluorobenzaldehyde?
The European Community (EC) number of 3-Fluorobenzaldehyde is 207-266-9.
What is the ChEMBL ID of 3-Fluorobenzaldehyde?
The ChEMBL ID of 3-Fluorobenzaldehyde is CHEMBL3884568.