What is the PubChem CID of 3-Dimethylaminopropylchloride hydrochloride?
The PubChem CID of 3-Dimethylaminopropylchloride hydrochloride is 94308.
What is the molecular formula of 3-Dimethylaminopropylchloride hydrochloride?
The molecular formula of 3-Dimethylaminopropylchloride hydrochloride is C5H13Cl2N.
What are the synonyms of 3-Dimethylaminopropylchloride hydrochloride?
The synonyms of 3-Dimethylaminopropylchloride hydrochloride include 5407-04-5, 3-chloro-N,N-dimethylpropan-1-amine hydrochloride, 3-Dimethylaminopropyl chloride hydrochloride, and 3-(Dimethylamino)propyl chloride hydrochloride.
What is the molecular weight of 3-Dimethylaminopropylchloride hydrochloride?
The molecular weight of 3-Dimethylaminopropylchloride hydrochloride is 158.07 g/mol.
What is the IUPAC name of 3-Dimethylaminopropylchloride hydrochloride?
The IUPAC name of 3-Dimethylaminopropylchloride hydrochloride is 3-chloro-N,N-dimethylpropan-1-amine;hydrochloride.
What is the InChI of 3-Dimethylaminopropylchloride hydrochloride?
The InChI of 3-Dimethylaminopropylchloride hydrochloride is InChI=1S/C5H12ClN.ClH/c1-7(2)5-3-4-6;/h3-5H2,1-2H3;1H.
What is the InChIKey of 3-Dimethylaminopropylchloride hydrochloride?
The InChIKey of 3-Dimethylaminopropylchloride hydrochloride is LJQNMDZRCXJETK-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Dimethylaminopropylchloride hydrochloride?
The canonical SMILES of 3-Dimethylaminopropylchloride hydrochloride is CN(C)CCCCl.Cl.
What is the CAS number of 3-Dimethylaminopropylchloride hydrochloride?
The CAS number of 3-Dimethylaminopropylchloride hydrochloride is 5407-04-5.
How many hydrogen bond donor counts does 3-Dimethylaminopropylchloride hydrochloride have?
3-Dimethylaminopropylchloride hydrochloride has 1 hydrogen bond donor count.
※ Please kindly note that our products are for research use only.