What is the molecular formula of 3-Deoxyestrone?
The molecular formula of 3-Deoxyestrone is C18H22O.
What is the molecular weight of 3-Deoxyestrone?
The molecular weight of 3-Deoxyestrone is 254.4 g/mol.
What is the IUPAC name of 3-Deoxyestrone?
The IUPAC name of 3-Deoxyestrone is (8R,9S,13S,14S)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
What is the InChI of 3-Deoxyestrone?
The InChI of 3-Deoxyestrone is InChI=1S/C18H22O/c1-18-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(18)8-9-17(18)19/h2-5,14-16H,6-11H2,1H3/t14-,15-,16+,18+/m1/s1.
What is the InChIKey of 3-Deoxyestrone?
The InChIKey of 3-Deoxyestrone is LGHBWDKMGOIZKH-CBZIJGRNSA-N.
What are the synonyms of 3-Deoxyestrone?
The synonyms of 3-Deoxyestrone are Adopron, 53-45-2, Deoxyestrone, Desoxyestrone, and more.
What is the XLogP3 value of 3-Deoxyestrone?
The XLogP3 value of 3-Deoxyestrone is 3.5.
How many hydrogen bond donor counts does 3-Deoxyestrone have?
3-Deoxyestrone has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Deoxyestrone have?
3-Deoxyestrone has 1 hydrogen bond acceptor count.
How many rotatable bond counts does 3-Deoxyestrone have?
3-Deoxyestrone has 0 rotatable bond counts.