What is the PubChem CID of 3-Chloro-but-2-enylamine?
PubChem CID 44890758.
What is the molecular formula of 3-Chloro-but-2-enylamine?
The molecular formula is C4H9Cl2N.
What is the molecular weight of 3-Chloro-but-2-enylamine?
The molecular weight is 142.02 g/mol.
What is the IUPAC name of 3-Chloro-but-2-enylamine?
The IUPAC name is (Z)-3-chlorobut-2-en-1-amine;hydrochloride.
What is the InChI of 3-Chloro-but-2-enylamine?
The InChI is InChI=1S/C4H8ClN.ClH/c1-4(5)2-3-6;/h2H,3,6H2,1H3;1H/b4-2-.
What is the InChIKey of 3-Chloro-but-2-enylamine?
The InChIKey is FNXILSDJRCHUDK-MKHFZPSSSA-N.
What is the canonical SMILES of 3-Chloro-but-2-enylamine?
The canonical SMILES is CC(=CCN)Cl.Cl.
What is the isomeric SMILES of 3-Chloro-but-2-enylamine?
The isomeric SMILES is C/C(=C/CN)/Cl.Cl.
How many hydrogen bond donor count does 3-Chloro-but-2-enylamine have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor count does 3-Chloro-but-2-enylamine have?
It has 1 hydrogen bond acceptor count.