What is the PubChem CID for 3-Chloro-4-iodoaniline?
PubChem CID 282926.
What is the molecular formula of 3-Chloro-4-iodoaniline?
The molecular formula is C6H5ClIN.
What is the molecular weight of 3-Chloro-4-iodoaniline?
The molecular weight is 253.47 g/mol.
What is the IUPAC name of 3-Chloro-4-iodoaniline?
The IUPAC name is 3-chloro-4-iodoaniline.
What is the InChI code for 3-Chloro-4-iodoaniline?
The InChI code is InChI=1S/C6H5ClIN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2.
What is the CAS number of 3-Chloro-4-iodoaniline?
The CAS number is 135050-44-1.
What is the XLogP3-AA value of 3-Chloro-4-iodoaniline?
The XLogP3-AA value is 2.5.
How many hydrogen bond donors are there in 3-Chloro-4-iodoaniline?
There is 1 hydrogen bond donor.
How many hydrogen bond acceptors are there in 3-Chloro-4-iodoaniline?
There is 1 hydrogen bond acceptor.
What is the topological polar surface area of 3-Chloro-4-iodoaniline?
The topological polar surface area is 26Ų.