What is the molecular formula of 3-Chloro-2-pentene?
The molecular formula of 3-Chloro-2-pentene is C5H9Cl.
What is the molecular weight of 3-Chloro-2-pentene?
The molecular weight of 3-Chloro-2-pentene is 104.58 g/mol.
When was 3-Chloro-2-pentene created?
3-Chloro-2-pentene was created on December 4, 2011.
When was 3-Chloro-2-pentene last modified?
3-Chloro-2-pentene was last modified on November 25, 2023.
What is the IUPAC name of 3-Chloro-2-pentene?
The IUPAC name of 3-Chloro-2-pentene is 3-chloropent-2-ene.
What is the InChI of 3-Chloro-2-pentene?
The InChI of 3-Chloro-2-pentene is InChI=1S/C5H9Cl/c1-3-5(6)4-2/h3H,4H2,1-2H3.
What is the InChIKey of 3-Chloro-2-pentene?
The InChIKey of 3-Chloro-2-pentene is VSQKJRIDGSFPSI-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chloro-2-pentene?
The canonical SMILES of 3-Chloro-2-pentene is CCC(=CC)Cl.
What is the XLogP3-AA value of 3-Chloro-2-pentene?
The XLogP3-AA value of 3-Chloro-2-pentene is 2.5.
Is 3-Chloro-2-pentene a canonical compound?
Yes, 3-Chloro-2-pentene is a canonical compound.