What is the molecular formula of 3-Chloro-2-methylphenol?
The molecular formula of 3-Chloro-2-methylphenol is C7H7ClO.
What is the molecular weight of 3-Chloro-2-methylphenol?
The molecular weight of 3-Chloro-2-methylphenol is 142.58 g/mol.
What is the IUPAC name of 3-Chloro-2-methylphenol?
The IUPAC name of 3-Chloro-2-methylphenol is 3-chloro-2-methylphenol.
What is the InChI of 3-Chloro-2-methylphenol?
The InChI of 3-Chloro-2-methylphenol is InChI=1S/C7H7ClO/c1-5-6(8)3-2-4-7(5)9/h2-4,9H,1H3.
What is the InChIKey of 3-Chloro-2-methylphenol?
The InChIKey of 3-Chloro-2-methylphenol is WADQOGCINABPRT-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chloro-2-methylphenol?
The canonical SMILES of 3-Chloro-2-methylphenol is CC1=C(C=CC=C1Cl)O.
What is the CAS number of 3-Chloro-2-methylphenol?
The CAS number of 3-Chloro-2-methylphenol is 3260-87-5.
What is the European Community (EC) number of 3-Chloro-2-methylphenol?
The European Community (EC) number of 3-Chloro-2-methylphenol is 221-861-0.
What is the DSSTox Substance ID of 3-Chloro-2-methylphenol?
The DSSTox Substance ID of 3-Chloro-2-methylphenol is DTXSID80186295.
Is 3-Chloro-2-methylphenol considered a canonicalized compound?
Yes, 3-Chloro-2-methylphenol is considered a canonicalized compound.