What is the molecular formula of 3-Chloro-2-iodotoluene?
The molecular formula is C7H6ClI.
What is the molecular weight of 3-Chloro-2-iodotoluene?
The molecular weight is 252.48 g/mol.
What is the IUPAC name of 3-Chloro-2-iodotoluene?
The IUPAC name is 1-chloro-2-iodo-3-methylbenzene.
What is the InChI of 3-Chloro-2-iodotoluene?
The InChI is InChI=1S/C7H6ClI/c1-5-3-2-4-6(8)7(5)9/h2-4H,1H3.
What is the InChIKey of 3-Chloro-2-iodotoluene?
The InChIKey is FTGLKPMFTLNUBN-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chloro-2-iodotoluene?
The canonical SMILES is CC1=C(C(=CC=C1)Cl)I.
What is the CAS number of 3-Chloro-2-iodotoluene?
The CAS number is 5100-98-1.
What is the European Community (EC) number of 3-Chloro-2-iodotoluene?
The European Community (EC) number is 681-000-3.
What is the DSSTox Substance ID of 3-Chloro-2-iodotoluene?
The DSSTox Substance ID is DTXSID10199010.
Is 3-Chloro-2-iodotoluene a canonicalized compound?
Yes, it is a canonicalized compound.