(3-Carboxypropyl)triphenylphosphonium bromide is used as antimalarial agents, antimycobacterial agents,antifungal agents, inhibitors of protein tyrosine phosphatase.
What is the chemical structure of 3-Carboxypropyl triphenylphosphonium bromide?
The chemical structure of 3-Carboxypropyl triphenylphosphonium bromide is represented by the formula C22H22BrO2P.
What is the CAS number of 3-Carboxypropyl triphenylphosphonium bromide?
The CAS number of 3-Carboxypropyl triphenylphosphonium bromide is 17857-14-6.
How many covalently-bonded units are present in the computed properties of 3-Carboxypropyl triphenylphosphonium bromide?
There are 2 covalently-bonded units present in the computed properties of 3-Carboxypropyl triphenylphosphonium bromide.
What is the molecular weight of 3-Carboxypropyl triphenylphosphonium bromide?
The molecular weight of 3-Carboxypropyl triphenylphosphonium bromide is 429.3 g/mol.
How many hydrogen bond acceptor counts are there in the computed properties of 3-Carboxypropyl triphenylphosphonium bromide?
There are 3 hydrogen bond acceptor counts in the computed properties of 3-Carboxypropyl triphenylphosphonium bromide.
What is the Canonical SMILES representation of 3-Carboxypropyl triphenylphosphonium bromide?
The Canonical SMILES representation of 3-Carboxypropyl triphenylphosphonium bromide is C1=CC=C(C=C1)[P+](CCCC(=O)O)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
What is the InChIKey identifier for 3-Carboxypropyl triphenylphosphonium bromide?
The InChIKey identifier for 3-Carboxypropyl triphenylphosphonium bromide is NKVJKVMGJABKHV-UHFFFAOYSA-N.
What are some of the depositor-supplied synonyms for 3-Carboxypropyl triphenylphosphonium bromide?
Some of the depositor-supplied synonyms for 3-Carboxypropyl triphenylphosphonium bromide include (3-Carboxypropyl)triphenylphosphonium bromide, MFCD00274196, and SCHEMBL484781.
What is the topological polar surface area of 3-Carboxypropyl triphenylphosphonium bromide?
The topological polar surface area of 3-Carboxypropyl triphenylphosphonium bromide is 37.3.
What is the IUPAC name of 3-Carboxypropyl triphenylphosphonium bromide?
The IUPAC name of 3-Carboxypropyl triphenylphosphonium bromide is 3-carboxypropyl(triphenyl)phosphanium;bromide.
※ Please kindly note that our products are for research use only.