What is the molecular formula of 3-Carboxy-4-fluorophenylboronic acid pinacol ester?
The molecular formula of 3-Carboxy-4-fluorophenylboronic acid pinacol ester is C13H16BFO4.
What is the molecular weight of 3-Carboxy-4-fluorophenylboronic acid pinacol ester?
The molecular weight of 3-Carboxy-4-fluorophenylboronic acid pinacol ester is 266.07 g/mol.
What is the IUPAC name of 3-Carboxy-4-fluorophenylboronic acid pinacol ester?
The IUPAC name of 3-Carboxy-4-fluorophenylboronic acid pinacol ester is 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
What is the InChI of 3-Carboxy-4-fluorophenylboronic acid pinacol ester?
The InChI of 3-Carboxy-4-fluorophenylboronic acid pinacol ester is "InChI=1S/C13H16BFO4/c1-12(2)13(3,4)19-14(18-12)8-5-6-10(15)9(7-8)11(16)17/h5-7H,1-4H3,(H,16,17)".
What is the InChIKey of 3-Carboxy-4-fluorophenylboronic acid pinacol ester?
The InChIKey of 3-Carboxy-4-fluorophenylboronic acid pinacol ester is "DXOXOBZCGBHKJS-UHFFFAOYSA-N".
What is the canonical SMILES of 3-Carboxy-4-fluorophenylboronic acid pinacol ester?
The canonical SMILES of 3-Carboxy-4-fluorophenylboronic acid pinacol ester is "B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)C(=O)O".
What is the CAS number of 3-Carboxy-4-fluorophenylboronic acid pinacol ester?
The CAS number of 3-Carboxy-4-fluorophenylboronic acid pinacol ester is 882679-10-9.
How many hydrogen bond donor counts does 3-Carboxy-4-fluorophenylboronic acid pinacol ester have?
3-Carboxy-4-fluorophenylboronic acid pinacol ester has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Carboxy-4-fluorophenylboronic acid pinacol ester have?
3-Carboxy-4-fluorophenylboronic acid pinacol ester has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does 3-Carboxy-4-fluorophenylboronic acid pinacol ester have?
3-Carboxy-4-fluorophenylboronic acid pinacol ester has 2 rotatable bond counts.
※ Please kindly note that our products are for research use only.