What is the PubChem CID of 3-Butenal diethyl acetal?
The PubChem CID of 3-Butenal diethyl acetal is 256426.
What is the molecular formula of 3-Butenal diethyl acetal?
The molecular formula of 3-Butenal diethyl acetal is C8H16O2.
What is the molecular weight of 3-Butenal diethyl acetal?
The molecular weight of 3-Butenal diethyl acetal is 144.21 g/mol.
What is the IUPAC name of 3-Butenal diethyl acetal?
The IUPAC name of 3-Butenal diethyl acetal is 4,4-diethoxybut-1-ene.
What is the InChI of 3-Butenal diethyl acetal?
The InChI of 3-Butenal diethyl acetal is InChI=1S/C8H16O2/c1-4-7-8(9-5-2)10-6-3/h4,8H,1,5-7H2,2-3H3.
What is the InChIKey of 3-Butenal diethyl acetal?
The InChIKey of 3-Butenal diethyl acetal is PRCYIYOCMALJCX-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Butenal diethyl acetal?
The Canonical SMILES of 3-Butenal diethyl acetal is CCOC(CC=C)OCC.
What is the CAS number of 3-Butenal diethyl acetal?
The CAS number of 3-Butenal diethyl acetal is 10602-36-5.
What is the EC number of 3-Butenal diethyl acetal?
The EC number of 3-Butenal diethyl acetal is 626-612-3.
Is 3-Butenal diethyl acetal a canonicalized compound?
Yes, 3-Butenal diethyl acetal is a canonicalized compound.