What is the molecular formula of 3-Bromophenetole?
The molecular formula of 3-Bromophenetole is C8H9BrO.
What is the molecular weight of 3-Bromophenetole?
The molecular weight of 3-Bromophenetole is 201.06 g/mol.
What is the CAS number of 3-Bromophenetole?
The CAS number of 3-Bromophenetole is 2655-84-7.
What is the IUPAC name of 3-Bromophenetole?
The IUPAC name of 3-Bromophenetole is 1-bromo-3-ethoxybenzene.
What is the InChI of 3-Bromophenetole?
The InChI of 3-Bromophenetole is InChI=1S/C8H9BrO/c1-2-10-8-5-3-4-7(9)6-8/h3-6H,2H2,1H3.
What is the InChIKey of 3-Bromophenetole?
The InChIKey of 3-Bromophenetole is LQBMPJSTUHWGDE-UHFFFAOYSA-N.
What is the XLogP3 value of 3-Bromophenetole?
The XLogP3 value of 3-Bromophenetole is 3.
How many hydrogen bond donor counts does 3-Bromophenetole have?
3-Bromophenetole has 0 hydrogen bond donor count.
How many rotatable bond counts does 3-Bromophenetole have?
3-Bromophenetole has 2 rotatable bond counts.
Is 3-Bromophenetole a canonicalized compound?
Yes, 3-Bromophenetole is a canonicalized compound.