What is the PubChem CID of 3-Bromodiphenyl ether?
PubChem CID 96165
What is the molecular formula of 3-Bromodiphenyl ether?
The molecular formula is C12H9BrO.
What are the synonyms of 3-Bromodiphenyl ether?
The synonyms include 1-Bromo-3-phenoxybenzene, 6876-00-2, 3-Phenoxybromobenzene, and Benzene, 1-bromo-3-phenoxy-.
What is the molecular weight of 3-Bromodiphenyl ether?
The molecular weight is 249.10 g/mol.
What is the IUPAC name of 3-Bromodiphenyl ether?
The IUPAC name is 1-bromo-3-phenoxybenzene.
What is the InChI of 3-Bromodiphenyl ether?
The InChI is InChI=1S/C12H9BrO/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9H.
What is the InChIKey of 3-Bromodiphenyl ether?
The InChIKey is AHDAKFFMKLQPTD-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromodiphenyl ether?
The canonical SMILES is C1=CC=C(C=C1)OC2=CC(=CC=C2)Br.
What is the CAS number of 3-Bromodiphenyl ether?
The CAS number is 6876-00-2.
Is 3-Bromodiphenyl ether a canonicalized compound?
Yes, 3-Bromodiphenyl ether is canonicalized according to PubChem.