What is the molecular formula of 3-Bromocinnamic acid?
The molecular formula of 3-Bromocinnamic acid is C9H7BrO2.
What is the molecular weight of 3-Bromocinnamic acid?
The molecular weight of 3-Bromocinnamic acid is 227.05 g/mol.
What is the IUPAC name of 3-Bromocinnamic acid?
The IUPAC name of 3-Bromocinnamic acid is (E)-3-(3-bromophenyl)prop-2-enoic acid.
What is the InChI of 3-Bromocinnamic acid?
The InChI of 3-Bromocinnamic acid is InChI=1S/C9H7BrO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6H,(H,11,12)/b5-4+.
What is the InChIKey of 3-Bromocinnamic acid?
The InChIKey of 3-Bromocinnamic acid is YEMUSDCFQUBPAL-SNAWJCMRSA-N.
What is the canonical SMILES of 3-Bromocinnamic acid?
The canonical SMILES of 3-Bromocinnamic acid is C1=CC(=CC(=C1)Br)C=CC(=O)O.
How many hydrogen bond donor counts are there in 3-Bromocinnamic acid?
There is one hydrogen bond donor count in 3-Bromocinnamic acid.
How many hydrogen bond acceptor counts are there in 3-Bromocinnamic acid?
There are two hydrogen bond acceptor counts in 3-Bromocinnamic acid.
How many rotatable bond counts are there in 3-Bromocinnamic acid?
There are two rotatable bond counts in 3-Bromocinnamic acid.
What is the topological polar surface area of 3-Bromocinnamic acid?
The topological polar surface area of 3-Bromocinnamic acid is 37.3Ų.