What is the molecular formula of 3-Bromobenzyl alcohol?
The molecular formula of 3-Bromobenzyl alcohol is C7H7BrO.
What is the molecular weight of 3-Bromobenzyl alcohol?
The molecular weight of 3-Bromobenzyl alcohol is 187.03 g/mol.
What is the IUPAC name of 3-Bromobenzyl alcohol?
The IUPAC name of 3-Bromobenzyl alcohol is (3-bromophenyl)methanol.
What is the InChI of 3-Bromobenzyl alcohol?
The InChI of 3-Bromobenzyl alcohol is InChI=1S/C7H7BrO/c8-7-3-1-2-6(4-7)5-9/h1-4,9H,5H2.
What is the InChIKey of 3-Bromobenzyl alcohol?
The InChIKey of 3-Bromobenzyl alcohol is FSWNRRSWFBXQCL-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromobenzyl alcohol?
The canonical SMILES of 3-Bromobenzyl alcohol is C1=CC(=CC(=C1)Br)CO.
What is the CAS number of 3-Bromobenzyl alcohol?
The CAS number of 3-Bromobenzyl alcohol is 15852-73-0.
What is the European Community (EC) Number of 3-Bromobenzyl alcohol?
The European Community (EC) Number of 3-Bromobenzyl alcohol is 239-975-4.
What is the ChEMBL ID of 3-Bromobenzyl alcohol?
The ChEMBL ID of 3-Bromobenzyl alcohol is CHEMBL2323842.
Is 3-Bromobenzyl alcohol a canonicalized compound?
Yes, 3-Bromobenzyl alcohol is a canonicalized compound.