What is the molecular formula of 3-Bromobenzotrifluoride?
The molecular formula of 3-Bromobenzotrifluoride is C7H4BrF3.
What is the molecular weight of 3-Bromobenzotrifluoride?
The molecular weight of 3-Bromobenzotrifluoride is 225.01 g/mol.
What is the IUPAC name of 3-Bromobenzotrifluoride?
The IUPAC name of 3-Bromobenzotrifluoride is 1-bromo-3-(trifluoromethyl)benzene.
What is the InChI of 3-Bromobenzotrifluoride?
The InChI of 3-Bromobenzotrifluoride is InChI=1S/C7H4BrF3/c8-6-3-1-2-5(4-6)7(9,10)11/h1-4H.
What is the InChIKey of 3-Bromobenzotrifluoride?
The InChIKey of 3-Bromobenzotrifluoride is NNMBNYHMJRJUBC-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromobenzotrifluoride?
The canonical SMILES of 3-Bromobenzotrifluoride is C1=CC(=CC(=C1)Br)C(F)(F)F.
What is the CAS number of 3-Bromobenzotrifluoride?
The CAS number of 3-Bromobenzotrifluoride is 401-78-5.
What is the European Community (EC) number of 3-Bromobenzotrifluoride?
The European Community (EC) number of 3-Bromobenzotrifluoride is 206-932-6.
What is the XLogP3 value of 3-Bromobenzotrifluoride?
The XLogP3 value of 3-Bromobenzotrifluoride is 4.
Is 3-Bromobenzotrifluoride a canonicalized compound?
Yes, 3-Bromobenzotrifluoride is a canonicalized compound.