What is the molecular formula of 3-Bromobenzonitrile?
The molecular formula of 3-Bromobenzonitrile is C7H4BrN.
What is the molecular weight of 3-Bromobenzonitrile?
The molecular weight of 3-Bromobenzonitrile is 182.02 g/mol.
What is the IUPAC name of 3-Bromobenzonitrile?
The IUPAC name of 3-Bromobenzonitrile is 3-bromobenzonitrile.
What is the InChI of 3-Bromobenzonitrile?
The InChI of 3-Bromobenzonitrile is InChI=1S/C7H4BrN/c8-7-3-1-2-6(4-7)5-9/h1-4H.
What is the InChIKey of 3-Bromobenzonitrile?
The InChIKey of 3-Bromobenzonitrile is STXAVEHFKAXGOX-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromobenzonitrile?
The canonical SMILES of 3-Bromobenzonitrile is C1=CC(=CC(=C1)Br)C#N.
What is the CAS number of 3-Bromobenzonitrile?
The CAS number of 3-Bromobenzonitrile is 6952-59-6.
What is the European Community (EC) number of 3-Bromobenzonitrile?
The European Community (EC) number of 3-Bromobenzonitrile is 230-127-9.
What is the DSSTox Substance ID of 3-Bromobenzonitrile?
The DSSTox Substance ID of 3-Bromobenzonitrile is DTXSID00219771.
Is 3-Bromobenzonitrile a canonicalized compound?
Yes, 3-Bromobenzonitrile is a canonicalized compound.