What is the molecular formula of 3-Bromo thiophenol?
The molecular formula of 3-Bromo thiophenol is C6H5BrS.
What is the molecular weight of 3-Bromo thiophenol?
The molecular weight of 3-Bromo thiophenol is 189.07 g/mol.
What is the IUPAC Name of 3-Bromo thiophenol?
The IUPAC Name of 3-Bromo thiophenol is 3-bromobenzenethiol.
What is the InChI of 3-Bromo thiophenol?
The InChI of 3-Bromo thiophenol is InChI=1S/C6H5BrS/c7-5-2-1-3-6(8)4-5/h1-4,8H.
What is the InChIKey of 3-Bromo thiophenol?
The InChIKey of 3-Bromo thiophenol is HNGQQUDFJDROPY-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo thiophenol?
The canonical SMILES of 3-Bromo thiophenol is C1=CC(=CC(=C1)Br)S.
What is the CAS number of 3-Bromo thiophenol?
The CAS number of 3-Bromo thiophenol is 6320-01-0.
What is the EC number of 3-Bromo thiophenol?
The EC number of 3-Bromo thiophenol is 228-664-9.
What is the DSSTox Substance ID of 3-Bromo thiophenol?
The DSSTox Substance ID of 3-Bromo thiophenol is DTXSID90212559.
Is 3-Bromo thiophenol a canonicalized compound?
Yes, 3-Bromo thiophenol is a canonicalized compound.