What is the molecular formula of 3-Bromo-9H-carbazole?
The molecular formula is C12H8BrN.
What is the molecular weight of 3-Bromo-9H-carbazole?
The molecular weight is 246.10 g/mol.
When was 3-Bromo-9H-carbazole created in PubChem?
It was created on March 26, 2005.
When was 3-Bromo-9H-carbazole last modified in PubChem?
It was last modified on December 2, 2023.
What is the IUPAC name of 3-Bromo-9H-carbazole?
The IUPAC name is 3-bromo-9H-carbazole.
What is the InChI (International Chemical Identifier) of 3-Bromo-9H-carbazole?
The InChI is InChI=1S/C12H8BrN/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7,14H.
What is the InChIKey of 3-Bromo-9H-carbazole?
The InChIKey is LTBWKAYPXIIVPC-UHFFFAOYSA-N.
What is the canonical SMILES (Simplified Molecular Input Line Entry System) of 3-Bromo-9H-carbazole?
The canonical SMILES is C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)Br.
What is the CAS (Chemical Abstracts Service) number of 3-Bromo-9H-carbazole?
The CAS number is 1592-95-6.
Is 3-Bromo-9H-carbazole a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.