At room temperature in the laboratory, 3-Bromo-6-fluoro-2-methoxyphenylboronic acid can catalyze the condensation of α -hydroxycarboxylic acid with excess alcohol.
What is the molecular formula of the compound?
The molecular formula is C7H7BBrFO3.
What is the molecular weight of the compound?
The molecular weight is 248.84 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is (3-bromo-6-fluoro-2-methoxyphenyl)boronic acid.
What is the InChI of the compound?
The InChI is InChI=1S/C7H7BBrFO3/c1-13-7-4(9)2-3-5(10)6(7)8(11)12/h2-3,11-12H,1H3.
What is the InChIKey of the compound?
The InChIKey is YJEJISGIPNUDBB-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES is B(C1=C(C=CC(=C1OC)Br)F)(O)O.
What is the CAS number of the compound?
The CAS number is 957120-30-8.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count is 4.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.