What is the PubChem CID of 3-Bromo-6-chloroaniline?
PubChem CID 3830731
What is the molecular formula of 3-Bromo-6-chloroaniline?
The molecular formula is C6H5BrClN.
What is the molecular weight of 3-Bromo-6-chloroaniline?
The molecular weight is 206.47 g/mol.
What is the IUPAC name of 3-Bromo-6-chloroaniline?
The IUPAC name is 5-bromo-2-chloroaniline.
What is the InChI of 3-Bromo-6-chloroaniline?
The InChI is InChI=1S/C6H5BrClN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2.
What is the InChIKey of 3-Bromo-6-chloroaniline?
The InChIKey is UGOLEPGQWYPIBR-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-6-chloroaniline?
The canonical SMILES is C1=CC(=C(C=C1Br)N)Cl.
What is the CAS number of 3-Bromo-6-chloroaniline?
The CAS number is 60811-17-8.
What is the European Community (EC) number of 3-Bromo-6-chloroaniline?
The European Community (EC) number is 640-719-2.
What is the XLogP3 value of 3-Bromo-6-chloroaniline?
The XLogP3 value is 3.