What is the molecular formula of 3-Bromo-5-iodoaniline?
The molecular formula of 3-Bromo-5-iodoaniline is C6H5BrIN.
What is the molecular weight of 3-Bromo-5-iodoaniline?
The molecular weight of 3-Bromo-5-iodoaniline is 297.92 g/mol.
What is the IUPAC name of 3-Bromo-5-iodoaniline?
The IUPAC name of 3-Bromo-5-iodoaniline is 3-bromo-5-iodoaniline.
What is the InChI of 3-Bromo-5-iodoaniline?
The InChI of 3-Bromo-5-iodoaniline is InChI=1S/C6H5BrIN/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2.
What is the InChIKey of 3-Bromo-5-iodoaniline?
The InChIKey of 3-Bromo-5-iodoaniline is SCXCUTCIFLAPMW-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Bromo-5-iodoaniline?
The Canonical SMILES of 3-Bromo-5-iodoaniline is C1=C(C=C(C=C1Br)I)N.
What is the CAS number of 3-Bromo-5-iodoaniline?
The CAS number of 3-Bromo-5-iodoaniline is 31948-87-5.
What is the European Community (EC) Number of 3-Bromo-5-iodoaniline?
The European Community (EC) Number of 3-Bromo-5-iodoaniline is 828-421-2.
What is the XLogP3-AA value of 3-Bromo-5-iodoaniline?
The XLogP3-AA value of 3-Bromo-5-iodoaniline is 2.6.
Is 3-Bromo-5-iodoaniline a canonicalized compound?
Yes, 3-Bromo-5-iodoaniline is a canonicalized compound.