What is the molecular formula of 3-Bromo-4-fluorothiophenol?
The molecular formula is C6H4BrFS.
What are the synonyms for 3-Bromo-4-fluorothiophenol?
The synonyms for 3-Bromo-4-fluorothiophenol are 942473-85-0, 3-bromo-4-fluorobenzenethiol, 3-Bromo-4-fluorobenzene-1-thiol, and 3-bromo-4-fluoro-benzenethiol.
What is the molecular weight of 3-Bromo-4-fluorothiophenol?
The molecular weight is 207.07 g/mol.
What is the IUPAC name of 3-Bromo-4-fluorothiophenol?
The IUPAC name is 3-bromo-4-fluorobenzenethiol.
What is the InChI of 3-Bromo-4-fluorothiophenol?
The InChI is InChI=1S/C6H4BrFS/c7-5-3-4(9)1-2-6(5)8/h1-3,9H.
What is the InChIKey of 3-Bromo-4-fluorothiophenol?
The InChIKey is HXQRAQKAGXRFEM-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-4-fluorothiophenol?
The canonical SMILES is C1=CC(=C(C=C1S)Br)F.
What is the CAS identifier for 3-Bromo-4-fluorothiophenol?
The CAS identifier is 942473-85-0.
What is the XLogP3-AA value of 3-Bromo-4-fluorothiophenol?
The XLogP3-AA value is 2.9.
Is 3-Bromo-4-fluorothiophenol a canonicalized compound?
Yes, 3-Bromo-4-fluorothiophenol is a canonicalized compound.
※ Please kindly note that our products are for research use only.