What is the molecular formula of 3-bromo-4-fluoropyridine?
The molecular formula of 3-bromo-4-fluoropyridine is C5H3BrFN.
What is the synonym for 3-bromo-4-fluoropyridine?
The synonym for 3-bromo-4-fluoropyridine is 116922-60-2 Pyridine, 3-bromo-4-fluoro- MFCD04114101 3-bromanyl-4-fluoranyl-pyridine.
What is the molecular weight of 3-bromo-4-fluoropyridine?
The molecular weight of 3-bromo-4-fluoropyridine is 175.99 g/mol.
When was 3-bromo-4-fluoropyridine created and modified?
3-bromo-4-fluoropyridine was created on July 19, 2005, and modified on December 2, 2023.
What is the IUPAC Name of 3-bromo-4-fluoropyridine?
The IUPAC Name of 3-bromo-4-fluoropyridine is 3-bromo-4-fluoropyridine.
What is the InChI of 3-bromo-4-fluoropyridine?
The InChI of 3-bromo-4-fluoropyridine is InChI=1S/C5H3BrFN/c6-4-3-8-2-1-5(4)7/h1-3H.
What is the InChIKey of 3-bromo-4-fluoropyridine?
The InChIKey of 3-bromo-4-fluoropyridine is PKYADCLPLQPPKK-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-bromo-4-fluoropyridine?
The Canonical SMILES of 3-bromo-4-fluoropyridine is C1=CN=CC(=C1F)Br.
What is the CAS number of 3-bromo-4-fluoropyridine?
The CAS number of 3-bromo-4-fluoropyridine is 116922-60-2.